C17H21N5O3 — CID 126475128
3-(5-amino-6-morpholin-4-ylpyrazin-2-yl)-N-(2-hydroxyethyl)benzamide (PubChem CID 126475128) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 3-(5-amino-6-morpholin-4-ylpyrazin-2-yl)-N-(2-hydroxyethyl)benzamide.
| Compound Name | 3-(5-amino-6-morpholin-4-ylpyrazin-2-yl)-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 126475128 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-(5-amino-6-morpholin-4-ylpyrazin-2-yl)-N-(2-hydroxyethyl)benzamide |
| SMILES | Nc1ncc(-c2cccc(C(=O)NCCO)c2)nc1N1CCOCC1 |
| InChI | InChI=1S/C17H21N5O3/c18-15-16(22-5-8-25-9-6-22)21-14(11-20-15)12-2-1-3-13(10-12)17(24)19-4-7-23/h1-3,10-11,23H,4-9H2,(H2,18,20)(H,19,24) |
| InChIKey | NILYHMSOHAIGRQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |