C22H22ClFN4O — CID 25107400
3-[6-amino-5-(4-chloro-3-fluorophenyl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 25107400) has the molecular formula C22H22ClFN4O and a molecular weight of 412.90 g/mol. Its IUPAC name is 3-[6-amino-5-(4-chloro-3-fluorophenyl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[6-amino-5-(4-chloro-3-fluorophenyl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 25107400 |
| Molecular Formula | C22H22ClFN4O |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-[6-amino-5-(4-chloro-3-fluorophenyl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CN(C)CCNC(=O)c1cccc(-c2cnc(N)c(-c3ccc(Cl)c(F)c3)c2)c1 |
| InChI | InChI=1S/C22H22ClFN4O/c1-28(2)9-8-26-22(29)16-5-3-4-14(10-16)17-11-18(21(25)27-13-17)15-6-7-19(23)20(24)12-15/h3-7,10-13H,8-9H2,1-2H3,(H2,25,27)(H,26,29) |
| InChIKey | AXSSQVATXYHRFH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |