C28H28N4O — CID 25106863
3-[6-amino-5-(4-phenylphenyl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 25106863) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-[6-amino-5-(4-phenylphenyl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[6-amino-5-(4-phenylphenyl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 25106863 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 3-[6-amino-5-(4-phenylphenyl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CN(C)CCNC(=O)c1cccc(-c2cnc(N)c(-c3ccc(-c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C28H28N4O/c1-32(2)16-15-30-28(33)24-10-6-9-23(17-24)25-18-26(27(29)31-19-25)22-13-11-21(12-14-22)20-7-4-3-5-8-20/h3-14,17-19H,15-16H2,1-2H3,(H2,29,31)(H,30,33) |
| InChIKey | OKIKTTAWRNMMSB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |