C33H26NO4+ — CID 58064905
[1-methoxy-12-methyl-3-(4-phenylphenyl)-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium-2-yl]methanol (PubChem CID 58064905) has the molecular formula C33H26NO4+ and a molecular weight of 500.57 g/mol. Its IUPAC name is [1-methoxy-12-methyl-3-(4-phenylphenyl)-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium-2-yl]methanol.
| Compound Name | [1-methoxy-12-methyl-3-(4-phenylphenyl)-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium-2-yl]methanol |
|---|---|
| PubChem CID | 58064905 |
| Molecular Formula | C33H26NO4+ |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | [1-methoxy-12-methyl-3-(4-phenylphenyl)-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium-2-yl]methanol |
| SMILES | COc1c(CO)c(-c2ccc(-c3ccccc3)cc2)cc2c1c[n+](C)c1c3cc4c(cc3ccc21)OCO4 |
| InChI | InChI=1S/C33H26NO4/c1-34-17-28-27(24-13-12-23-14-30-31(38-19-37-30)16-26(23)32(24)34)15-25(29(18-35)33(28)36-2)22-10-8-21(9-11-22)20-6-4-3-5-7-20/h3-17,35H,18-19H2,1-2H3/q+1 |
| InChIKey | MLKVEABTCYDXIS-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|