C34H30NO4+ — CID 58064977
[2,3,7-trimethoxy-5-methyl-1-(4-phenylphenyl)benzo[c]phenanthridin-5-ium-8-yl]methanol (PubChem CID 58064977) has the molecular formula C34H30NO4+ and a molecular weight of 516.62 g/mol. Its IUPAC name is [2,3,7-trimethoxy-5-methyl-1-(4-phenylphenyl)benzo[c]phenanthridin-5-ium-8-yl]methanol.
| Compound Name | [2,3,7-trimethoxy-5-methyl-1-(4-phenylphenyl)benzo[c]phenanthridin-5-ium-8-yl]methanol |
|---|---|
| PubChem CID | 58064977 |
| Molecular Formula | C34H30NO4+ |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | [2,3,7-trimethoxy-5-methyl-1-(4-phenylphenyl)benzo[c]phenanthridin-5-ium-8-yl]methanol |
| SMILES | COc1cc2c(ccc3c4ccc(CO)c(OC)c4c[n+](C)c23)c(-c2ccc(-c3ccccc3)cc2)c1OC |
| InChI | InChI=1S/C34H30NO4/c1-35-19-29-25(15-14-24(20-36)33(29)38-3)27-17-16-26-28(32(27)35)18-30(37-2)34(39-4)31(26)23-12-10-22(11-13-23)21-8-6-5-7-9-21/h5-19,36H,20H2,1-4H3/q+1 |
| InChIKey | PQFJRDKOMLQFFI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|