C30H30NO4+ — CID 58064918
(2,3-dimethoxy-5-methyl-1-phenyl-7-propan-2-yloxybenzo[c]phenanthridin-5-ium-8-yl)methanol (PubChem CID 58064918) has the molecular formula C30H30NO4+ and a molecular weight of 468.57 g/mol. Its IUPAC name is (2,3-dimethoxy-5-methyl-1-phenyl-7-propan-2-yloxybenzo[c]phenanthridin-5-ium-8-yl)methanol.
| Compound Name | (2,3-dimethoxy-5-methyl-1-phenyl-7-propan-2-yloxybenzo[c]phenanthridin-5-ium-8-yl)methanol |
|---|---|
| PubChem CID | 58064918 |
| Molecular Formula | C30H30NO4+ |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (2,3-dimethoxy-5-methyl-1-phenyl-7-propan-2-yloxybenzo[c]phenanthridin-5-ium-8-yl)methanol |
| SMILES | COc1cc2c(ccc3c4ccc(CO)c(OC(C)C)c4c[n+](C)c23)c(-c2ccccc2)c1OC |
| InChI | InChI=1S/C30H30NO4/c1-18(2)35-29-20(17-32)11-12-21-23-14-13-22-24(28(23)31(3)16-25(21)29)15-26(33-4)30(34-5)27(22)19-9-7-6-8-10-19/h6-16,18,32H,17H2,1-5H3/q+1 |
| InChIKey | GZUWMZIMQQOJGQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|