C33H28NO4+ — CID 66602929
[11-(hydroxymethyl)-3,4-dimethoxy-13-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium-10-yl]methanol (PubChem CID 66602929) has the molecular formula C33H28NO4+ and a molecular weight of 502.59 g/mol. Its IUPAC name is [11-(hydroxymethyl)-3,4-dimethoxy-13-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium-10-yl]methanol.
| Compound Name | [11-(hydroxymethyl)-3,4-dimethoxy-13-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium-10-yl]methanol |
|---|---|
| PubChem CID | 66602929 |
| Molecular Formula | C33H28NO4+ |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | [11-(hydroxymethyl)-3,4-dimethoxy-13-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium-10-yl]methanol |
| SMILES | COc1ccc2c(cc[n+]3cc4cc(CO)c(CO)cc4c(-c4ccc(-c5ccccc5)cc4)c23)c1OC |
| InChI | InChI=1S/C33H28NO4/c1-37-30-13-12-27-28(33(30)38-2)14-15-34-18-24-16-25(19-35)26(20-36)17-29(24)31(32(27)34)23-10-8-22(9-11-23)21-6-4-3-5-7-21/h3-18,35-36H,19-20H2,1-2H3/q+1 |
| InChIKey | APPMVUVONJIVSQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 63.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|