C27H24NO3+ — CID 66602729
[10-(hydroxymethyl)-3-methoxy-8-methyl-2-phenylisoquinolino[2,1-b]isoquinolin-7-ium-11-yl]methanol (PubChem CID 66602729) has the molecular formula C27H24NO3+ and a molecular weight of 410.49 g/mol. Its IUPAC name is [10-(hydroxymethyl)-3-methoxy-8-methyl-2-phenylisoquinolino[2,1-b]isoquinolin-7-ium-11-yl]methanol.
| Compound Name | [10-(hydroxymethyl)-3-methoxy-8-methyl-2-phenylisoquinolino[2,1-b]isoquinolin-7-ium-11-yl]methanol |
|---|---|
| PubChem CID | 66602729 |
| Molecular Formula | C27H24NO3+ |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [10-(hydroxymethyl)-3-methoxy-8-methyl-2-phenylisoquinolino[2,1-b]isoquinolin-7-ium-11-yl]methanol |
| SMILES | COc1cc2cc[n+]3c(C)c4cc(CO)c(CO)cc4cc3c2cc1-c1ccccc1 |
| InChI | InChI=1S/C27H24NO3/c1-17-23-11-22(16-30)21(15-29)10-20(23)12-26-24-14-25(18-6-4-3-5-7-18)27(31-2)13-19(24)8-9-28(17)26/h3-14,29-30H,15-16H2,1-2H3/q+1 |
| InChIKey | RBBSPOPYUQPHDH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 53.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|