C31H28NO2+ — CID 66602539
[7-(hydroxymethyl)-1,2-dimethyl-3-[3-(4-phenylphenyl)phenyl]isoquinolin-2-ium-6-yl]methanol (PubChem CID 66602539) has the molecular formula C31H28NO2+ and a molecular weight of 446.57 g/mol. Its IUPAC name is [7-(hydroxymethyl)-1,2-dimethyl-3-[3-(4-phenylphenyl)phenyl]isoquinolin-2-ium-6-yl]methanol.
| Compound Name | [7-(hydroxymethyl)-1,2-dimethyl-3-[3-(4-phenylphenyl)phenyl]isoquinolin-2-ium-6-yl]methanol |
|---|---|
| PubChem CID | 66602539 |
| Molecular Formula | C31H28NO2+ |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | [7-(hydroxymethyl)-1,2-dimethyl-3-[3-(4-phenylphenyl)phenyl]isoquinolin-2-ium-6-yl]methanol |
| SMILES | Cc1c2cc(CO)c(CO)cc2cc(-c2cccc(-c3ccc(-c4ccccc4)cc3)c2)[n+]1C |
| InChI | InChI=1S/C31H28NO2/c1-21-30-17-29(20-34)28(19-33)16-27(30)18-31(32(21)2)26-10-6-9-25(15-26)24-13-11-23(12-14-24)22-7-4-3-5-8-22/h3-18,33-34H,19-20H2,1-2H3/q+1 |
| InChIKey | OMRHBQYUDOGREW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|