C21H24NO4+ — CID 23296079
3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1,2-dimethylisoquinolin-2-ium (PubChem CID 23296079) has the molecular formula C21H24NO4+ and a molecular weight of 354.43 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1,2-dimethylisoquinolin-2-ium.
| Compound Name | 3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1,2-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 23296079 |
| Molecular Formula | C21H24NO4+ |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1,2-dimethylisoquinolin-2-ium |
| SMILES | COc1ccc(-c2cc3cc(OC)c(OC)cc3c(C)[n+]2C)cc1OC |
| InChI | InChI=1S/C21H24NO4/c1-13-16-12-21(26-6)20(25-5)11-15(16)9-17(22(13)2)14-7-8-18(23-3)19(10-14)24-4/h7-12H,1-6H3/q+1 |
| InChIKey | SQWSKUOGBLOCND-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|