C16H16NO2+ — CID 3301517
8,9-dimethoxy-5-methylphenanthridin-5-ium (PubChem CID 3301517) has the molecular formula C16H16NO2+ and a molecular weight of 254.31 g/mol. Its IUPAC name is 8,9-dimethoxy-5-methylphenanthridin-5-ium.
| Compound Name | 8,9-dimethoxy-5-methylphenanthridin-5-ium |
|---|---|
| PubChem CID | 3301517 |
| Molecular Formula | C16H16NO2+ |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 8,9-dimethoxy-5-methylphenanthridin-5-ium |
| SMILES | COc1cc2c[n+](C)c3ccccc3c2cc1OC |
| InChI | InChI=1S/C16H16NO2/c1-17-10-11-8-15(18-2)16(19-3)9-13(11)12-6-4-5-7-14(12)17/h4-10H,1-3H3/q+1 |
| InChIKey | JYXCVWQNWVRMHK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|