C14H12NO2+ — CID 12831238
5-methylphenanthridin-5-ium-8,9-diol (PubChem CID 12831238) has the molecular formula C14H12NO2+ and a molecular weight of 226.25 g/mol. Its IUPAC name is 5-methylphenanthridin-5-ium-8,9-diol.
| Compound Name | 5-methylphenanthridin-5-ium-8,9-diol |
|---|---|
| PubChem CID | 12831238 |
| Molecular Formula | C14H12NO2+ |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 5-methylphenanthridin-5-ium-8,9-diol |
| SMILES | C[n+]1cc2cc(O)c(O)cc2c2ccccc21 |
| InChI | InChI=1S/C14H11NO2/c1-15-8-9-6-13(16)14(17)7-11(9)10-4-2-3-5-12(10)15/h2-8,16H,1H3/p+1 |
| InChIKey | XGCDFTNNGXUGBN-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|