C20H15IN2 — CID 118723068
4-methyl-13-aza-4-azoniapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1,3,5,7,9,11,14,16,18,20-decaene iodide (PubChem CID 118723068) has the molecular formula C20H15IN2 and a molecular weight of 410.26 g/mol. Its IUPAC name is 4-methyl-13-aza-4-azoniapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1,3,5,7,9,11,14,16,18,20-decaene iodide.
| Compound Name | 4-methyl-13-aza-4-azoniapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1,3,5,7,9,11,14,16,18,20-decaene iodide |
|---|---|
| PubChem CID | 118723068 |
| Molecular Formula | C20H15IN2 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 4-methyl-13-aza-4-azoniapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1,3,5,7,9,11,14,16,18,20-decaene iodide |
| SMILES | C[n+]1cc2c(cn3c4ccccc4ccc23)c2ccccc21.[I-] |
| InChI | InChI=1S/C20H15N2.HI/c1-21-12-17-16(15-7-3-5-9-19(15)21)13-22-18-8-4-2-6-14(18)10-11-20(17)22;/h2-13H,1H3;1H/q+1;/p-1 |
| InChIKey | HFRZFQRBHRJPTG-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|