C18H14NO4+ — CID 25138382
5-methylbenzo[c]phenanthridin-5-ium-2,3,7,8-tetrol (PubChem CID 25138382) has the molecular formula C18H14NO4+ and a molecular weight of 308.31 g/mol. Its IUPAC name is 5-methylbenzo[c]phenanthridin-5-ium-2,3,7,8-tetrol.
| Compound Name | 5-methylbenzo[c]phenanthridin-5-ium-2,3,7,8-tetrol |
|---|---|
| PubChem CID | 25138382 |
| Molecular Formula | C18H14NO4+ |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-methylbenzo[c]phenanthridin-5-ium-2,3,7,8-tetrol |
| SMILES | C[n+]1cc2c(O)c(O)ccc2c2ccc3cc(O)c(O)cc3c21 |
| InChI | InChI=1S/C18H13NO4/c1-19-8-13-10(4-5-14(20)18(13)23)11-3-2-9-6-15(21)16(22)7-12(9)17(11)19/h2-8H,1H3,(H3,20,21,22,23)/p+1 |
| InChIKey | PESFOXRZSOTTCW-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 84.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|