C19H16BrNO3 — CID 53343548
9,10-dimethoxyisoquinolino[2,1-a]quinolin-5-ium-7-ol bromide (PubChem CID 53343548) has the molecular formula C19H16BrNO3 and a molecular weight of 386.25 g/mol. Its IUPAC name is 9,10-dimethoxyisoquinolino[2,1-a]quinolin-5-ium-7-ol bromide.
| Compound Name | 9,10-dimethoxyisoquinolino[2,1-a]quinolin-5-ium-7-ol bromide |
|---|---|
| PubChem CID | 53343548 |
| Molecular Formula | C19H16BrNO3 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 9,10-dimethoxyisoquinolino[2,1-a]quinolin-5-ium-7-ol bromide |
| SMILES | COc1cc2c(O)c[n+]3c4ccccc4ccc3c2cc1OC.[Br-] |
| InChI | InChI=1S/C19H15NO3.BrH/c1-22-18-9-13-14(10-19(18)23-2)17(21)11-20-15-6-4-3-5-12(15)7-8-16(13)20;/h3-11H,1-2H3;1H |
| InChIKey | NQGSMCQAAHSHLA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 42.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|