C21H22NO4+ — CID 54212311
1-methoxy-2-[2-(2,4,6-trimethoxyphenyl)ethenyl]quinolin-1-ium (PubChem CID 54212311) has the molecular formula C21H22NO4+ and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-methoxy-2-[2-(2,4,6-trimethoxyphenyl)ethenyl]quinolin-1-ium.
| Compound Name | 1-methoxy-2-[2-(2,4,6-trimethoxyphenyl)ethenyl]quinolin-1-ium |
|---|---|
| PubChem CID | 54212311 |
| Molecular Formula | C21H22NO4+ |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-methoxy-2-[2-(2,4,6-trimethoxyphenyl)ethenyl]quinolin-1-ium |
| SMILES | COc1cc(OC)c(C=Cc2ccc3ccccc3[n+]2OC)c(OC)c1 |
| InChI | InChI=1S/C21H22NO4/c1-23-17-13-20(24-2)18(21(14-17)25-3)12-11-16-10-9-15-7-5-6-8-19(15)22(16)26-4/h5-14H,1-4H3/q+1 |
| InChIKey | PWTQYWQTKISHMA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|