C17H20INO3 — CID 54612482
1-methyl-2-[(Z)-2-(2,4,6-trimethoxyphenyl)ethenyl]pyridin-1-ium iodide (PubChem CID 54612482) has the molecular formula C17H20INO3 and a molecular weight of 413.26 g/mol. Its IUPAC name is 1-methyl-2-[(Z)-2-(2,4,6-trimethoxyphenyl)ethenyl]pyridin-1-ium iodide.
| Compound Name | 1-methyl-2-[(Z)-2-(2,4,6-trimethoxyphenyl)ethenyl]pyridin-1-ium iodide |
|---|---|
| PubChem CID | 54612482 |
| Molecular Formula | C17H20INO3 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 1-methyl-2-[(Z)-2-(2,4,6-trimethoxyphenyl)ethenyl]pyridin-1-ium iodide |
| SMILES | COc1cc(OC)c(/C=C\c2cccc[n+]2C)c(OC)c1.[I-] |
| InChI | InChI=1S/C17H20NO3.HI/c1-18-10-6-5-7-13(18)8-9-15-16(20-3)11-14(19-2)12-17(15)21-4;/h5-12H,1-4H3;1H/q+1;/p-1/b9-8-; |
| InChIKey | SYBRQGQWBWTCPS-UOQXYWCXSA-M |
| XLogP | -0.29 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|