C17H20NO3+ — CID 92959596
1-methyl-2-[(Z)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium (PubChem CID 92959596) has the molecular formula C17H20NO3+ and a molecular weight of 286.35 g/mol. Its IUPAC name is 1-methyl-2-[(Z)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium.
| Compound Name | 1-methyl-2-[(Z)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 92959596 |
| Molecular Formula | C17H20NO3+ |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-methyl-2-[(Z)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium |
| SMILES | COc1ccc(/C=C\c2cccc[n+]2C)c(OC)c1OC |
| InChI | InChI=1S/C17H20NO3/c1-18-12-6-5-7-14(18)10-8-13-9-11-15(19-2)17(21-4)16(13)20-3/h5-12H,1-4H3/q+1/b10-8- |
| InChIKey | HJKQOKWUMMPBJD-NTMALXAHSA-N |
| XLogP | 2.71 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|