C18H23N2O3+ — CID 23815951
2-[4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine (PubChem CID 23815951) has the molecular formula C18H23N2O3+ and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-[4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine.
| Compound Name | 2-[4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
|---|---|
| PubChem CID | 23815951 |
| Molecular Formula | C18H23N2O3+ |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-[4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
| SMILES | COc1ccc(/C=C/c2cc[n+](CCN)cc2)c(OC)c1OC |
| InChI | InChI=1S/C18H23N2O3/c1-21-16-7-6-15(17(22-2)18(16)23-3)5-4-14-8-11-20(12-9-14)13-10-19/h4-9,11-12H,10,13,19H2,1-3H3/q+1/b5-4+ |
| InChIKey | NDFWIPKTXQEYFI-SNAWJCMRSA-N |
| XLogP | 2.13 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|