C40H50N2O6S2+2 — CID 89327952
4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1-[4-[4-[4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]butyldisulfanyl]butyl]pyridin-1-ium (PubChem CID 89327952) has the molecular formula C40H50N2O6S2+2 and a molecular weight of 718.98 g/mol. Its IUPAC name is 4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1-[4-[4-[4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]butyldisulfanyl]butyl]pyridin-1-ium.
| Compound Name | 4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1-[4-[4-[4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]butyldisulfanyl]butyl]pyridin-1-ium |
|---|---|
| PubChem CID | 89327952 |
| Molecular Formula | C40H50N2O6S2+2 |
| Molecular Weight | 718.98 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | 4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1-[4-[4-[4-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]butyldisulfanyl]butyl]pyridin-1-ium |
| SMILES | COc1ccc(/C=C/c2cc[n+](CCCCSSCCCC[n+]3ccc(/C=C/c4ccc(OC)c(OC)c4OC)cc3)cc2)c(OC)c1OC |
| InChI | InChI=1S/C40H50N2O6S2/c1-43-35-17-15-33(37(45-3)39(35)47-5)13-11-31-19-25-41(26-20-31)23-7-9-29-49-50-30-10-8-24-42-27-21-32(22-28-42)12-14-34-16-18-36(44-2)40(48-6)38(34)46-4/h11-22,25-28H,7-10,23-24,29-30H2,1-6H3/q+2/b13-11+,14-12+ |
| InChIKey | RGAABQVFBLDVBW-PHEQNACWSA-N |
| XLogP | 8.30 |
| TPSA | 63.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.98 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|