C23H30NO4S+ — CID 138638193
S-[6-[4-[(E)-2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]hexyl] ethanethioate (PubChem CID 138638193) has the molecular formula C23H30NO4S+ and a molecular weight of 416.56 g/mol. Its IUPAC name is S-[6-[4-[(E)-2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]hexyl] ethanethioate.
| Compound Name | S-[6-[4-[(E)-2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]hexyl] ethanethioate |
|---|---|
| PubChem CID | 138638193 |
| Molecular Formula | C23H30NO4S+ |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | S-[6-[4-[(E)-2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]hexyl] ethanethioate |
| SMILES | COc1cc(/C=C/c2cc[n+](CCCCCCSC(C)=O)cc2)cc(OC)c1O |
| InChI | InChI=1S/C23H29NO4S/c1-18(25)29-15-7-5-4-6-12-24-13-10-19(11-14-24)8-9-20-16-21(27-2)23(26)22(17-20)28-3/h8-11,13-14,16-17H,4-7,12,15H2,1-3H3/p+1 |
| InChIKey | BCSJKWLOXFAWKF-UHFFFAOYSA-O |
| XLogP | 4.71 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|