C12H14O4S — CID 169458511
S-[3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enyl] ethanethioate (PubChem CID 169458511) has the molecular formula C12H14O4S and a molecular weight of 254.31 g/mol. Its IUPAC name is S-[3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169458511 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | S-[3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enyl] ethanethioate |
| SMILES | COc1cc(C=CCSC(C)=O)cc(O)c1O |
| InChI | InChI=1S/C12H14O4S/c1-8(13)17-5-3-4-9-6-10(14)12(15)11(7-9)16-2/h3-4,6-7,14-15H,5H2,1-2H3 |
| InChIKey | OTTSFYUJYDRYAW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|