C19H28O2S — CID 169458363
S-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enyl] ethanethioate (PubChem CID 169458363) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is S-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169458363 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | S-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H28O2S/c1-13(20)22-10-8-9-14-11-15(18(2,3)4)17(21)16(12-14)19(5,6)7/h8-9,11-12,21H,10H2,1-7H3 |
| InChIKey | JLMGWIMUWSRJPX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|