C13H16O2S — CID 169457133
S-[3-(4-hydroxy-2,6-dimethylphenyl)prop-2-enyl] ethanethioate (PubChem CID 169457133) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is S-[3-(4-hydroxy-2,6-dimethylphenyl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(4-hydroxy-2,6-dimethylphenyl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169457133 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | S-[3-(4-hydroxy-2,6-dimethylphenyl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1c(C)cc(O)cc1C |
| InChI | InChI=1S/C13H16O2S/c1-9-7-12(15)8-10(2)13(9)5-4-6-16-11(3)14/h4-5,7-8,15H,6H2,1-3H3 |
| InChIKey | SWFHZPDRCALGQK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|