C13H16OS — CID 169456739
S-[3-(2,5-dimethylphenyl)prop-2-enyl] ethanethioate (PubChem CID 169456739) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is S-[3-(2,5-dimethylphenyl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(2,5-dimethylphenyl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169456739 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | S-[3-(2,5-dimethylphenyl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1cc(C)ccc1C |
| InChI | InChI=1S/C13H16OS/c1-10-6-7-11(2)13(9-10)5-4-8-15-12(3)14/h4-7,9H,8H2,1-3H3 |
| InChIKey | VYMYAYNOPMFILY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|