C20H24ClNO4 — CID 82026368
5-[4-[(Z)-2-(3-ethoxy-4-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]pentanoic acid chloride (PubChem CID 82026368) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is 5-[4-[(Z)-2-(3-ethoxy-4-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]pentanoic acid chloride.
| Compound Name | 5-[4-[(Z)-2-(3-ethoxy-4-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]pentanoic acid chloride |
|---|---|
| PubChem CID | 82026368 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 5-[4-[(Z)-2-(3-ethoxy-4-hydroxyphenyl)ethenyl]pyridin-1-ium-1-yl]pentanoic acid chloride |
| SMILES | CCOc1cc(/C=C\c2cc[n+](CCCCC(=O)O)cc2)ccc1O.[Cl-] |
| InChI | InChI=1S/C20H23NO4.ClH/c1-2-25-19-15-17(8-9-18(19)22)7-6-16-10-13-21(14-11-16)12-4-3-5-20(23)24;/h6-11,13-15H,2-5,12H2,1H3,(H,23,24);1H |
| InChIKey | BLGVSNNQUAUSJZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|