C21H27N2O2+ — CID 66643442
6-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid (PubChem CID 66643442) has the molecular formula C21H27N2O2+ and a molecular weight of 339.46 g/mol. Its IUPAC name is 6-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 66643442 |
| Molecular Formula | C21H27N2O2+ |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 6-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid |
| SMILES | CN(C)c1ccc(/C=C/c2cc[n+](CCCCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O2/c1-22(2)20-11-9-18(10-12-20)7-8-19-13-16-23(17-14-19)15-5-3-4-6-21(24)25/h7-14,16-17H,3-6,15H2,1-2H3/p+1 |
| InChIKey | DYFAMNVMRNIUTG-UHFFFAOYSA-O |
| XLogP | 3.86 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|