C23H29N2O2S2+ — CID 123995130
dithian-4-yl 4-[4-[2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butanoate (PubChem CID 123995130) has the molecular formula C23H29N2O2S2+ and a molecular weight of 429.63 g/mol. Its IUPAC name is dithian-4-yl 4-[4-[2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butanoate.
| Compound Name | dithian-4-yl 4-[4-[2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butanoate |
|---|---|
| PubChem CID | 123995130 |
| Molecular Formula | C23H29N2O2S2+ |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | dithian-4-yl 4-[4-[2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butanoate |
| SMILES | CN(C)c1ccc(C=Cc2cc[n+](CCCC(=O)OC3CCSSC3)cc2)cc1 |
| InChI | InChI=1S/C23H29N2O2S2/c1-24(2)21-9-7-19(8-10-21)5-6-20-11-15-25(16-12-20)14-3-4-23(26)27-22-13-17-28-29-18-22/h5-12,15-16,22H,3-4,13-14,17-18H2,1-2H3/q+1 |
| InChIKey | WLKWAMJRFOPSSV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|