C28H39N4O4S2+ — CID 123522224
N-[3-[4-[4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butanoylamino]propyl]dithiolane-4-carboxamide (PubChem CID 123522224) has the molecular formula C28H39N4O4S2+ and a molecular weight of 559.78 g/mol. Its IUPAC name is N-[3-[4-[4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butanoylamino]propyl]dithiolane-4-carboxamide.
| Compound Name | N-[3-[4-[4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butanoylamino]propyl]dithiolane-4-carboxamide |
|---|---|
| PubChem CID | 123522224 |
| Molecular Formula | C28H39N4O4S2+ |
| Molecular Weight | 559.78 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | N-[3-[4-[4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butanoylamino]propyl]dithiolane-4-carboxamide |
| SMILES | O=C(CCC[n+]1ccc(C=Cc2ccc(N(CCO)CCO)cc2)cc1)NCCCNC(=O)C1CSSC1 |
| InChI | InChI=1S/C28H38N4O4S2/c33-19-17-32(18-20-34)26-8-6-23(7-9-26)4-5-24-10-15-31(16-11-24)14-1-3-27(35)29-12-2-13-30-28(36)25-21-37-38-22-25/h4-11,15-16,25,33-34H,1-3,12-14,17-22H2,(H-,29,30,35,36)/p+1 |
| InChIKey | UBJSNMFOFOXDRX-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.78 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|