C24H34N3O3S2+ — CID 123994587
N-[3-[2-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]propyl]-3-sulfanyl-2-(sulfanylmethyl)propanamide (PubChem CID 123994587) has the molecular formula C24H34N3O3S2+ and a molecular weight of 476.69 g/mol. Its IUPAC name is N-[3-[2-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]propyl]-3-sulfanyl-2-(sulfanylmethyl)propanamide.
| Compound Name | N-[3-[2-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]propyl]-3-sulfanyl-2-(sulfanylmethyl)propanamide |
|---|---|
| PubChem CID | 123994587 |
| Molecular Formula | C24H34N3O3S2+ |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-[3-[2-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]propyl]-3-sulfanyl-2-(sulfanylmethyl)propanamide |
| SMILES | O=C(NCCC[n+]1ccccc1C=Cc1ccc(N(CCO)CCO)cc1)C(CS)CS |
| InChI | InChI=1S/C24H33N3O3S2/c28-16-14-27(15-17-29)23-9-6-20(7-10-23)5-8-22-4-1-2-12-26(22)13-3-11-25-24(30)21(18-31)19-32/h1-2,4-10,12,21,28-29H,3,11,13-19H2,(H2-,25,30,31,32)/p+1 |
| InChIKey | RTCXTBZZGOMMMP-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|