C18H25N2O2S+ — CID 145332250
2-[N-(2-hydroxyethyl)-4-[(E)-2-pyridin-1-ium-4-ylethenyl]anilino]ethanol;methanethiol (PubChem CID 145332250) has the molecular formula C18H25N2O2S+ and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-[N-(2-hydroxyethyl)-4-[(E)-2-pyridin-1-ium-4-ylethenyl]anilino]ethanol;methanethiol.
| Compound Name | 2-[N-(2-hydroxyethyl)-4-[(E)-2-pyridin-1-ium-4-ylethenyl]anilino]ethanol;methanethiol |
|---|---|
| PubChem CID | 145332250 |
| Molecular Formula | C18H25N2O2S+ |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[N-(2-hydroxyethyl)-4-[(E)-2-pyridin-1-ium-4-ylethenyl]anilino]ethanol;methanethiol |
| SMILES | CS.OCCN(CCO)c1ccc(/C=C/c2cc[nH+]cc2)cc1 |
| InChI | InChI=1S/C17H20N2O2.CH4S/c20-13-11-19(12-14-21)17-5-3-15(4-6-17)1-2-16-7-9-18-10-8-16;1-2/h1-10,20-21H,11-14H2;2H,1H3/p+1/b2-1+; |
| InChIKey | JZFOXDMNECSWBG-TYYBGVCCSA-O |
| XLogP | 2.01 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|