C16H19N3O — CID 138670984
2-[N-ethyl-4-[(E)-2-pyrimidin-4-ylethenyl]anilino]ethanol (PubChem CID 138670984) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-[N-ethyl-4-[(E)-2-pyrimidin-4-ylethenyl]anilino]ethanol.
| Compound Name | 2-[N-ethyl-4-[(E)-2-pyrimidin-4-ylethenyl]anilino]ethanol |
|---|---|
| PubChem CID | 138670984 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-[N-ethyl-4-[(E)-2-pyrimidin-4-ylethenyl]anilino]ethanol |
| SMILES | CCN(CCO)c1ccc(/C=C/c2ccncn2)cc1 |
| InChI | InChI=1S/C16H19N3O/c1-2-19(11-12-20)16-7-4-14(5-8-16)3-6-15-9-10-17-13-18-15/h3-10,13,20H,2,11-12H2,1H3/b6-3+ |
| InChIKey | OLCPTDKCWNWGHH-ZZXKWVIFSA-N |
| XLogP | 2.47 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|