C27H39NO4S — CID 54060983
6-[N-(6-hydroxyhexyl)-4-[2-(4-methylsulfonylphenyl)ethenyl]anilino]hexan-1-ol (PubChem CID 54060983) has the molecular formula C27H39NO4S and a molecular weight of 473.68 g/mol. Its IUPAC name is 6-[N-(6-hydroxyhexyl)-4-[2-(4-methylsulfonylphenyl)ethenyl]anilino]hexan-1-ol.
| Compound Name | 6-[N-(6-hydroxyhexyl)-4-[2-(4-methylsulfonylphenyl)ethenyl]anilino]hexan-1-ol |
|---|---|
| PubChem CID | 54060983 |
| Molecular Formula | C27H39NO4S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 6-[N-(6-hydroxyhexyl)-4-[2-(4-methylsulfonylphenyl)ethenyl]anilino]hexan-1-ol |
| SMILES | CS(=O)(=O)c1ccc(C=Cc2ccc(N(CCCCCCO)CCCCCCO)cc2)cc1 |
| InChI | InChI=1S/C27H39NO4S/c1-33(31,32)27-18-14-25(15-19-27)11-10-24-12-16-26(17-13-24)28(20-6-2-4-8-22-29)21-7-3-5-9-23-30/h10-19,29-30H,2-9,20-23H2,1H3 |
| InChIKey | LZRKJZQBTIXGMA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|