C21H23NO2S — CID 54297094
4-[2-(4-methylsulfonylphenyl)ethenyl]-N,N-bis(prop-2-enyl)aniline (PubChem CID 54297094) has the molecular formula C21H23NO2S and a molecular weight of 353.49 g/mol. Its IUPAC name is 4-[2-(4-methylsulfonylphenyl)ethenyl]-N,N-bis(prop-2-enyl)aniline.
| Compound Name | 4-[2-(4-methylsulfonylphenyl)ethenyl]-N,N-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 54297094 |
| Molecular Formula | C21H23NO2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[2-(4-methylsulfonylphenyl)ethenyl]-N,N-bis(prop-2-enyl)aniline |
| SMILES | C=CCN(CC=C)c1ccc(C=Cc2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H23NO2S/c1-4-16-22(17-5-2)20-12-8-18(9-13-20)6-7-19-10-14-21(15-11-19)25(3,23)24/h4-15H,1-2,16-17H2,3H3 |
| InChIKey | SBNULKJKRAMQOK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|