C24H28N2S — CID 139763508
4-[4-[bis(prop-2-enyl)amino]phenyl]sulfanyl-N,N-bis(prop-2-enyl)aniline (PubChem CID 139763508) has the molecular formula C24H28N2S and a molecular weight of 376.57 g/mol. Its IUPAC name is 4-[4-[bis(prop-2-enyl)amino]phenyl]sulfanyl-N,N-bis(prop-2-enyl)aniline.
| Compound Name | 4-[4-[bis(prop-2-enyl)amino]phenyl]sulfanyl-N,N-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 139763508 |
| Molecular Formula | C24H28N2S |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 4-[4-[bis(prop-2-enyl)amino]phenyl]sulfanyl-N,N-bis(prop-2-enyl)aniline |
| SMILES | C=CCN(CC=C)c1ccc(Sc2ccc(N(CC=C)CC=C)cc2)cc1 |
| InChI | InChI=1S/C24H28N2S/c1-5-17-25(18-6-2)21-9-13-23(14-10-21)27-24-15-11-22(12-16-24)26(19-7-3)20-8-4/h5-16H,1-4,17-20H2 |
| InChIKey | WDTCGJICJYNUIG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|