C18H22N2S — CID 5574
N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine (PubChem CID 5574) has the molecular formula C18H22N2S and a molecular weight of 298.45 g/mol. Its IUPAC name is N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine.
| Compound Name | N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine |
|---|---|
| PubChem CID | 5574 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine |
| SMILES | CC(CN(C)C)CN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C18H22N2S/c1-14(12-19(2)3)13-20-15-8-4-6-10-17(15)21-18-11-7-5-9-16(18)20/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | ZZHLYYDVIOPZBE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|