C20H28N2O5S2 — CID 140556773
2-[N-(2-hydroxyethyl)-4-[(E)-2-[1-(2-sulfanylethyl)pyridin-1-ium-4-yl]ethenyl]anilino]ethanol;methanesulfonate (PubChem CID 140556773) has the molecular formula C20H28N2O5S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-[N-(2-hydroxyethyl)-4-[(E)-2-[1-(2-sulfanylethyl)pyridin-1-ium-4-yl]ethenyl]anilino]ethanol;methanesulfonate.
| Compound Name | 2-[N-(2-hydroxyethyl)-4-[(E)-2-[1-(2-sulfanylethyl)pyridin-1-ium-4-yl]ethenyl]anilino]ethanol;methanesulfonate |
|---|---|
| PubChem CID | 140556773 |
| Molecular Formula | C20H28N2O5S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-[N-(2-hydroxyethyl)-4-[(E)-2-[1-(2-sulfanylethyl)pyridin-1-ium-4-yl]ethenyl]anilino]ethanol;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].OCCN(CCO)c1ccc(/C=C/c2cc[n+](CCS)cc2)cc1 |
| InChI | InChI=1S/C19H24N2O2S.CH4O3S/c22-14-11-21(12-15-23)19-5-3-17(4-6-19)1-2-18-7-9-20(10-8-18)13-16-24;1-5(2,3)4/h1-10,22-23H,11-16H2;1H3,(H,2,3,4) |
| InChIKey | CUYRBOKQWBXTRK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|