C20H25NO6S — CID 22450722
[4-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] ethyl sulfate (PubChem CID 22450722) has the molecular formula C20H25NO6S and a molecular weight of 407.49 g/mol. Its IUPAC name is [4-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] ethyl sulfate.
| Compound Name | [4-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] ethyl sulfate |
|---|---|
| PubChem CID | 22450722 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [4-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] ethyl sulfate |
| SMILES | CCOS(=O)(=O)Oc1ccc(/C=C/c2ccc(N(CCO)CCO)cc2)cc1 |
| InChI | InChI=1S/C20H25NO6S/c1-2-26-28(24,25)27-20-11-7-18(8-12-20)4-3-17-5-9-19(10-6-17)21(13-15-22)14-16-23/h3-12,22-23H,2,13-16H2,1H3/b4-3+ |
| InChIKey | CZBAKHPCNLOUEY-ONEGZZNKSA-N |
| XLogP | 2.31 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|