About carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol
carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol (PubChem CID 71435780) has the molecular formula C13H23N3O7
and a molecular weight of 333.34 g/mol. Its IUPAC name is carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol.
Molecular Properties
| Compound Name | carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol |
| PubChem CID | 71435780 |
| Molecular Formula | C13H23N3O7 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol |
| SMILES | COc1ccc(N(CCO)CCO)cc1.NC(=O)O.NC(=O)O |
| InChI | InChI=1S/C11H17NO3.2CH3NO2/c1-15-11-4-2-10(3-5-11)12(6-8-13)7-9-14;2*2-1(3)4/h2-5,13-14H,6-9H2,1H3;2*2H2,(H,3,4) |
| InChIKey | NRCNZNIDGGEVCK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 179.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol?
The IUPAC name of carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol (CID 71435780) is carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol.
What is the SMILES notation for carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol?
The canonical SMILES for carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol is COc1ccc(N(CCO)CCO)cc1.NC(=O)O.NC(=O)O.
What is the InChIKey of carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol?
The InChIKey is NRCNZNIDGGEVCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3.2CH3NO2/c1-15-11-4-2-10(3-5-11)12(6-8-13)7-9-14;2*2-1(3)4/h2-5,13-14H,6-9H2,1H3;2*2H2,(H,3,4).
What are the key properties of carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol?
carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol has a molecular weight of 333.34 g/mol, XLogP of -0.27, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;2-[N-(2-hydroxyethyl)-4-methoxyanilino]ethanol is sourced from PubChem (CID 71435780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).