About [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate
[4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate (PubChem CID 22450778) has the molecular formula C21H27NO5S
and a molecular weight of 405.52 g/mol. Its IUPAC name is [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate.
Molecular Properties
| Compound Name | [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate |
| PubChem CID | 22450778 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate |
| SMILES | CCN(C)c1ccc(/C=C/c2ccc(OS(=O)(=O)OCCCCO)cc2)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-3-22(2)20-12-8-18(9-13-20)6-7-19-10-14-21(15-11-19)27-28(24,25)26-17-5-4-16-23/h6-15,23H,3-5,16-17H2,1-2H3/b7-6+ |
| InChIKey | KJFXILHZUPXBTQ-VOTSOKGWSA-N |
| XLogP | 3.73 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate?
The IUPAC name of [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate (CID 22450778) is [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate.
What is the SMILES notation for [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate?
The canonical SMILES for [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate is CCN(C)c1ccc(/C=C/c2ccc(OS(=O)(=O)OCCCCO)cc2)cc1.
What is the InChIKey of [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate?
The InChIKey is KJFXILHZUPXBTQ-VOTSOKGWSA-N. The full InChI is InChI=1S/C21H27NO5S/c1-3-22(2)20-12-8-18(9-13-20)6-7-19-10-14-21(15-11-19)27-28(24,25)26-17-5-4-16-23/h6-15,23H,3-5,16-17H2,1-2H3/b7-6+.
What are the key properties of [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate?
[4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate has a molecular weight of 405.52 g/mol, XLogP of 3.73, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-2-[4-[ethyl(methyl)amino]phenyl]ethenyl]phenyl] 4-hydroxybutyl sulfate is sourced from PubChem (CID 22450778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).