About [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate
[4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate (PubChem CID 54137159) has the molecular formula C24H33NO7S
and a molecular weight of 479.60 g/mol. Its IUPAC name is [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate.
Molecular Properties
| Compound Name | [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate |
| PubChem CID | 54137159 |
| Molecular Formula | C24H33NO7S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate |
| SMILES | O=S(=O)(OCCCCCCO)Oc1ccc(C=Cc2ccc(N(CCO)CCO)cc2)cc1 |
| InChI | InChI=1S/C24H33NO7S/c26-17-3-1-2-4-20-31-33(29,30)32-24-13-9-22(10-14-24)6-5-21-7-11-23(12-8-21)25(15-18-27)16-19-28/h5-14,26-28H,1-4,15-20H2 |
| InChIKey | NYNNNSSQYCDXEO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate?
The IUPAC name of [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate (CID 54137159) is [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate.
What is the SMILES notation for [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate?
The canonical SMILES for [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate is O=S(=O)(OCCCCCCO)Oc1ccc(C=Cc2ccc(N(CCO)CCO)cc2)cc1.
What is the InChIKey of [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate?
The InChIKey is NYNNNSSQYCDXEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33NO7S/c26-17-3-1-2-4-20-31-33(29,30)32-24-13-9-22(10-14-24)6-5-21-7-11-23(12-8-21)25(15-18-27)16-19-28/h5-14,26-28H,1-4,15-20H2.
What are the key properties of [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate?
[4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate has a molecular weight of 479.60 g/mol, XLogP of 2.84, 16 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]phenyl] 6-hydroxyhexyl sulfate is sourced from PubChem (CID 54137159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).