C22H32N3O2+ — CID 142746744
2-[4-[2-[1-(5-aminopentyl)pyridin-1-ium-4-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 142746744) has the molecular formula C22H32N3O2+ and a molecular weight of 370.52 g/mol. Its IUPAC name is 2-[4-[2-[1-(5-aminopentyl)pyridin-1-ium-4-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-[2-[1-(5-aminopentyl)pyridin-1-ium-4-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 142746744 |
| Molecular Formula | C22H32N3O2+ |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2-[4-[2-[1-(5-aminopentyl)pyridin-1-ium-4-yl]ethenyl]-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | NCCCCC[n+]1ccc(C=Cc2ccc(N(CCO)CCO)cc2)cc1 |
| InChI | InChI=1S/C22H32N3O2/c23-12-2-1-3-13-24-14-10-21(11-15-24)5-4-20-6-8-22(9-7-20)25(16-18-26)17-19-27/h4-11,14-15,26-27H,1-3,12-13,16-19,23H2/q+1 |
| InChIKey | SPJSVWSJLDQQDB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|