C26H38N4O2S+2 — CID 143546836
[4-[4-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butylsulfanyl-(methylamino)methylidene]-ethenyl-methylazanium (PubChem CID 143546836) has the molecular formula C26H38N4O2S+2 and a molecular weight of 470.68 g/mol. Its IUPAC name is [4-[4-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butylsulfanyl-(methylamino)methylidene]-ethenyl-methylazanium.
| Compound Name | [4-[4-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butylsulfanyl-(methylamino)methylidene]-ethenyl-methylazanium |
|---|---|
| PubChem CID | 143546836 |
| Molecular Formula | C26H38N4O2S+2 |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | [4-[4-[(E)-2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]butylsulfanyl-(methylamino)methylidene]-ethenyl-methylazanium |
| SMILES | C=C/[N+](C)=C(\NC)SCCCC[n+]1ccc(/C=C/c2ccc(N(CCO)CCO)cc2)cc1 |
| InChI | InChI=1S/C26H37N4O2S/c1-4-28(3)26(27-2)33-22-6-5-15-29-16-13-24(14-17-29)8-7-23-9-11-25(12-10-23)30(18-20-31)19-21-32/h4,7-14,16-17,31-32H,1,5-6,15,18-22H2,2-3H3/q+1/p+1 |
| InChIKey | ZOCVEYZICJOSNZ-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|