C35H42N3O2S2+ — CID 123270943
2-[4-[3-ethenyl-5-[2-[2-[4-[2-(4-methylphenyl)ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethylimino]penta-1,3-dienyl]-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 123270943) has the molecular formula C35H42N3O2S2+ and a molecular weight of 600.87 g/mol. Its IUPAC name is 2-[4-[3-ethenyl-5-[2-[2-[4-[2-(4-methylphenyl)ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethylimino]penta-1,3-dienyl]-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-[3-ethenyl-5-[2-[2-[4-[2-(4-methylphenyl)ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethylimino]penta-1,3-dienyl]-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 123270943 |
| Molecular Formula | C35H42N3O2S2+ |
| Molecular Weight | 600.87 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 2-[4-[3-ethenyl-5-[2-[2-[4-[2-(4-methylphenyl)ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethylimino]penta-1,3-dienyl]-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | C=CC(C=Cc1ccc(N(CCO)CCO)cc1)=C/C=N/CCSSCC[n+]1ccc(C=Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C35H42N3O2S2/c1-3-31(8-9-33-12-14-35(15-13-33)38(23-26-39)24-27-40)16-19-36-20-28-41-42-29-25-37-21-17-34(18-22-37)11-10-32-6-4-30(2)5-7-32/h3-19,21-22,39-40H,1,20,23-29H2,2H3/q+1/b9-8?,11-10?,31-16?,36-19+ |
| InChIKey | VDWADIRSSXPJEO-YZDKLCQNSA-N |
| XLogP | 6.52 |
| TPSA | 59.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.87 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|