C30H31N4S2+ — CID 143547067
4-[(E)-2-[1-[2-[[(E)-2-[[(2E,4E)-5-(4-aminophenyl)-3-ethenylpenta-2,4-dienylidene]amino]ethenyl]disulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]aniline (PubChem CID 143547067) has the molecular formula C30H31N4S2+ and a molecular weight of 511.74 g/mol. Its IUPAC name is 4-[(E)-2-[1-[2-[[(E)-2-[[(2E,4E)-5-(4-aminophenyl)-3-ethenylpenta-2,4-dienylidene]amino]ethenyl]disulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]aniline.
| Compound Name | 4-[(E)-2-[1-[2-[[(E)-2-[[(2E,4E)-5-(4-aminophenyl)-3-ethenylpenta-2,4-dienylidene]amino]ethenyl]disulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 143547067 |
| Molecular Formula | C30H31N4S2+ |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 4-[(E)-2-[1-[2-[[(E)-2-[[(2E,4E)-5-(4-aminophenyl)-3-ethenylpenta-2,4-dienylidene]amino]ethenyl]disulfanyl]ethyl]pyridin-1-ium-4-yl]ethenyl]aniline |
| SMILES | C=CC(/C=C/c1ccc(N)cc1)=C\C=N\C=C\SSCC[n+]1ccc(/C=C/c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C30H30N4S2/c1-2-25(3-4-26-7-11-29(31)12-8-26)15-18-33-19-23-35-36-24-22-34-20-16-28(17-21-34)6-5-27-9-13-30(32)14-10-27/h2-21,23,32H,1,22,24H2,(H2,31,33)/p+1/b23-19+ |
| InChIKey | QSCZMPVCYWCSDO-FCDQGJHFSA-O |
| XLogP | 7.06 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|