C36H38N4S2 — CID 142495699
6-[(1E,3Z)-3-[(Z)-2-aminoethenyl]penta-1,3-dienyl]naphthalen-2-amine;6-[(1E,3E,5E)-3-ethenyl-5-(ethyldisulfanyl)iminopenta-1,3-dienyl]naphthalen-2-amine (PubChem CID 142495699) has the molecular formula C36H38N4S2 and a molecular weight of 590.86 g/mol. Its IUPAC name is 6-[(1E,3Z)-3-[(Z)-2-aminoethenyl]penta-1,3-dienyl]naphthalen-2-amine;6-[(1E,3E,5E)-3-ethenyl-5-(ethyldisulfanyl)iminopenta-1,3-dienyl]naphthalen-2-amine.
| Compound Name | 6-[(1E,3Z)-3-[(Z)-2-aminoethenyl]penta-1,3-dienyl]naphthalen-2-amine;6-[(1E,3E,5E)-3-ethenyl-5-(ethyldisulfanyl)iminopenta-1,3-dienyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 142495699 |
| Molecular Formula | C36H38N4S2 |
| Molecular Weight | 590.86 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 6-[(1E,3Z)-3-[(Z)-2-aminoethenyl]penta-1,3-dienyl]naphthalen-2-amine;6-[(1E,3E,5E)-3-ethenyl-5-(ethyldisulfanyl)iminopenta-1,3-dienyl]naphthalen-2-amine |
| SMILES | C/C=C(\C=C/N)/C=C/c1ccc2cc(N)ccc2c1.C=CC(/C=C/c1ccc2cc(N)ccc2c1)=C\C=N\SSCC |
| InChI | InChI=1S/C19H20N2S2.C17H18N2/c1-3-15(11-12-21-23-22-4-2)5-6-16-7-8-18-14-19(20)10-9-17(18)13-16;1-2-13(9-10-18)3-4-14-5-6-16-12-17(19)8-7-15(16)11-14/h3,5-14H,1,4,20H2,2H3;2-12H,18-19H2,1H3/b6-5+,15-11+,21-12+;4-3+,10-9-,13-2- |
| InChIKey | NFTJHINVZOYEOR-HDILIHPESA-N |
| XLogP | 9.79 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.86 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|