C15H21NS — CID 142094465
ethane;(2E,4E)-3-ethenyl-N-methyl-5-(5-methylthiophen-3-yl)penta-2,4-dien-1-imine (PubChem CID 142094465) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is ethane;(2E,4E)-3-ethenyl-N-methyl-5-(5-methylthiophen-3-yl)penta-2,4-dien-1-imine.
| Compound Name | ethane;(2E,4E)-3-ethenyl-N-methyl-5-(5-methylthiophen-3-yl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142094465 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | ethane;(2E,4E)-3-ethenyl-N-methyl-5-(5-methylthiophen-3-yl)penta-2,4-dien-1-imine |
| SMILES | C=CC(/C=C/c1csc(C)c1)=C\C=N\C.CC |
| InChI | InChI=1S/C13H15NS.C2H6/c1-4-12(7-8-14-3)5-6-13-9-11(2)15-10-13;1-2/h4-10H,1H2,2-3H3;1-2H3/b6-5+,12-7+,14-8+; |
| InChIKey | CLODREKXIYSBIN-RENIPXSHSA-N |
| XLogP | 4.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|