C17H18 — CID 145390100
2-ethyl-6-[(1E)-3-methylbuta-1,3-dienyl]naphthalene (PubChem CID 145390100) has the molecular formula C17H18 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-ethyl-6-[(1E)-3-methylbuta-1,3-dienyl]naphthalene.
| Compound Name | 2-ethyl-6-[(1E)-3-methylbuta-1,3-dienyl]naphthalene |
|---|---|
| PubChem CID | 145390100 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-ethyl-6-[(1E)-3-methylbuta-1,3-dienyl]naphthalene |
| SMILES | C=C(C)/C=C/c1ccc2cc(CC)ccc2c1 |
| InChI | InChI=1S/C17H18/c1-4-14-7-9-17-12-15(6-5-13(2)3)8-10-16(17)11-14/h5-12H,2,4H2,1,3H3/b6-5+ |
| InChIKey | WQICWZQSYARCQF-AATRIKPKSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|