C22H25N — CID 146649498
N-(2,4-dimethylphenyl)-1-[4-[(1E)-3-methylbuta-1,3-dienyl]phenyl]propan-2-imine (PubChem CID 146649498) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-[4-[(1E)-3-methylbuta-1,3-dienyl]phenyl]propan-2-imine.
| Compound Name | N-(2,4-dimethylphenyl)-1-[4-[(1E)-3-methylbuta-1,3-dienyl]phenyl]propan-2-imine |
|---|---|
| PubChem CID | 146649498 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-[4-[(1E)-3-methylbuta-1,3-dienyl]phenyl]propan-2-imine |
| SMILES | C=C(C)/C=C/c1ccc(C/C(C)=N/c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C22H25N/c1-16(2)6-8-20-9-11-21(12-10-20)15-19(5)23-22-13-7-17(3)14-18(22)4/h6-14H,1,15H2,2-5H3/b8-6+,23-19+ |
| InChIKey | RSFIZBPRDKGSDE-DIVXDVBKSA-N |
| XLogP | 6.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|