C11H12S — CID 142934935
4-[(1E)-3-methylbuta-1,3-dienyl]benzenethiol (PubChem CID 142934935) has the molecular formula C11H12S and a molecular weight of 176.28 g/mol. Its IUPAC name is 4-[(1E)-3-methylbuta-1,3-dienyl]benzenethiol.
| Compound Name | 4-[(1E)-3-methylbuta-1,3-dienyl]benzenethiol |
|---|---|
| PubChem CID | 142934935 |
| Molecular Formula | C11H12S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 4-[(1E)-3-methylbuta-1,3-dienyl]benzenethiol |
| SMILES | C=C(C)/C=C/c1ccc(S)cc1 |
| InChI | InChI=1S/C11H12S/c1-9(2)3-4-10-5-7-11(12)8-6-10/h3-8,12H,1H2,2H3/b4-3+ |
| InChIKey | AAQADZIMGPFOOC-ONEGZZNKSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|